C20H25N7O2 — CID 67094333
1-ethyl-3-[4-[9-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-2-yl]phenyl]urea (PubChem CID 67094333) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 1-ethyl-3-[4-[9-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[9-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 67094333 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-ethyl-3-[4-[9-methyl-6-[(3S)-3-methylmorpholin-4-yl]purin-2-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(-c2nc(N3CCOC[C@@H]3C)c3ncn(C)c3n2)cc1 |
| InChI | InChI=1S/C20H25N7O2/c1-4-21-20(28)23-15-7-5-14(6-8-15)17-24-18-16(22-12-26(18)3)19(25-17)27-9-10-29-11-13(27)2/h5-8,12-13H,4,9-11H2,1-3H3,(H2,21,23,28)/t13-/m0/s1 |
| InChIKey | HMPQQYCOBUJYSG-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |