C24H33N3O5 — CID 67094553
(2R)-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[(1S)-2,2-dimethyl-1-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-4-methylpentanamide (PubChem CID 67094553) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[(1S)-2,2-dimethyl-1-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-4-methylpentanamide.
| Compound Name | (2R)-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[(1S)-2,2-dimethyl-1-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 67094553 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (2R)-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[(1S)-2,2-dimethyl-1-(5-phenyl-1,2,4-oxadiazol-3-yl)propyl]-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)N[C@H](c1noc(-c2ccccc2)n1)C(C)(C)C)C1OC(C)(C)OC1=O |
| InChI | InChI=1S/C24H33N3O5/c1-14(2)13-16(17-22(29)31-24(6,7)30-17)20(28)25-18(23(3,4)5)19-26-21(32-27-19)15-11-9-8-10-12-15/h8-12,14,16-18H,13H2,1-7H3,(H,25,28)/t16?,17?,18-/m1/s1 |
| InChIKey | YOLKRIOZZIPRKN-DAWZGUTISA-N |
| XLogP | 4.28 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |