About 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine
8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 67095033) has the molecular formula C15H12ClN3O
and a molecular weight of 285.73 g/mol. Its IUPAC name is 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 67095033 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Clc1ccc2nc(-c3cccc4c3OCCN4)[nH]c2c1 |
| InChI | InChI=1S/C15H12ClN3O/c16-9-4-5-11-13(8-9)19-15(18-11)10-2-1-3-12-14(10)20-7-6-17-12/h1-5,8,17H,6-7H2,(H,18,19) |
| InChIKey | ALTVVNYECHLICK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (CID 67095033) is 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine is Clc1ccc2nc(-c3cccc4c3OCCN4)[nH]c2c1.
What is the InChIKey of 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is ALTVVNYECHLICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O/c16-9-4-5-11-13(8-9)19-15(18-11)10-2-1-3-12-14(10)20-7-6-17-12/h1-5,8,17H,6-7H2,(H,18,19).
What are the key properties of 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 285.73 g/mol, XLogP of 3.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(6-chloro-1H-benzimidazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 67095033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).