About 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid
2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid (PubChem CID 67095305) has the molecular formula C23H24ClN3O4
and a molecular weight of 441.92 g/mol. Its IUPAC name is 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid |
| PubChem CID | 67095305 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1[nH]nc2ccc(Cl)cc12.O=C(O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13NO2.C11H11ClN2O2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;1-2-7(11(15)16)10-8-5-6(12)3-4-9(8)13-14-10/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);3-5,7H,2H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | KRAREHIXIOMPDU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid?
The IUPAC name of 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid (CID 67095305) is 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid.
What is the SMILES notation for 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid?
The canonical SMILES for 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid is CCC(C(=O)O)c1[nH]nc2ccc(Cl)cc12.O=C(O)CCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid?
The InChIKey is KRAREHIXIOMPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.C11H11ClN2O2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;1-2-7(11(15)16)10-8-5-6(12)3-4-9(8)13-14-10/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);3-5,7H,2H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid?
2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid has a molecular weight of 441.92 g/mol, XLogP of 5.37, 7 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2H-indazol-3-yl)butanoic acid;4-(1H-indol-3-yl)butanoic acid is sourced from PubChem (CID 67095305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).