C26H26N4O5 — CID 67095406
(2S)-1-benzyl-N-[4-[methyl(1,3-oxazol-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 67095406) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2S)-1-benzyl-N-[4-[methyl(1,3-oxazol-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-benzyl-N-[4-[methyl(1,3-oxazol-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67095406 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (2S)-1-benzyl-N-[4-[methyl(1,3-oxazol-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)C(=O)C(Cc1ccccc1)NC(=O)[C@@H]1CCC(=O)N1Cc1ccccc1)c1ncco1 |
| InChI | InChI=1S/C26H26N4O5/c1-29(26-27-14-15-35-26)25(34)23(32)20(16-18-8-4-2-5-9-18)28-24(33)21-12-13-22(31)30(21)17-19-10-6-3-7-11-19/h2-11,14-15,20-21H,12-13,16-17H2,1H3,(H,28,33)/t20?,21-/m0/s1 |
| InChIKey | VHEPHMXVKSVKJW-LBAQZLPGSA-N |
| XLogP | 2.13 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|