About azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine
azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine (PubChem CID 67095695) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine.
Molecular Properties
| Compound Name | azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine |
| PubChem CID | 67095695 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine |
| SMILES | C=CC[C@H]1CC[C@@H](N)[C@@H](C)O1.N |
| InChI | InChI=1S/C9H17NO.H3N/c1-3-4-8-5-6-9(10)7(2)11-8;/h3,7-9H,1,4-6,10H2,2H3;1H3/t7-,8+,9-;/m1./s1 |
| InChIKey | QOPRJUNOQSIJSK-RVKMJUHISA-N |
| XLogP | 1.62 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine?
The IUPAC name of azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine (CID 67095695) is azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine.
What is the SMILES notation for azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine?
The canonical SMILES for azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine is C=CC[C@H]1CC[C@@H](N)[C@@H](C)O1.N.
What is the InChIKey of azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine?
The InChIKey is QOPRJUNOQSIJSK-RVKMJUHISA-N. The full InChI is InChI=1S/C9H17NO.H3N/c1-3-4-8-5-6-9(10)7(2)11-8;/h3,7-9H,1,4-6,10H2,2H3;1H3/t7-,8+,9-;/m1./s1.
What are the key properties of azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine?
azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine has a molecular weight of 172.27 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2R,3R,6R)-2-methyl-6-prop-2-enyloxan-3-amine is sourced from PubChem (CID 67095695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).