C23H29N3O2 — CID 67096247
(1R,7S,10R)-8-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-4-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 67096247) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (1R,7S,10R)-8-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-4-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,7S,10R)-8-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-4-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 67096247 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (1R,7S,10R)-8-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-4-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1C[C@H]2C(C)=C[C@@H]1n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C23H29N3O2/c1-15(2)9-8-10-16(3)19-14-20-17(4)13-21(19)26-23(28)24(22(27)25(20)26)18-11-6-5-7-12-18/h5-7,9,11-13,16,19-21H,8,10,14H2,1-4H3/t16-,19-,20+,21+/m1/s1 |
| InChIKey | FJVMZQJHTNDZSE-DBOLQNLKSA-N |
| XLogP | 4.25 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|