C26H35N3OS — CID 67096612
3-(1-benzothiophen-3-yl)-2-butyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-5-carboxamide (PubChem CID 67096612) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-2-butyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | 3-(1-benzothiophen-3-yl)-2-butyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 67096612 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-2-butyl-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCCCN1N=C(C(=O)N[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)CC1c1csc2ccccc12 |
| InChI | InChI=1S/C26H35N3OS/c1-5-6-13-29-21(19-16-31-22-10-8-7-9-18(19)22)15-20(28-29)24(30)27-23-14-17-11-12-26(23,4)25(17,2)3/h7-10,16-17,21,23H,5-6,11-15H2,1-4H3,(H,27,30)/t17-,21?,23+,26+/m1/s1 |
| InChIKey | YOYKABIHBZSDSV-DOOUOIKASA-N |
| XLogP | 6.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |