C19H30O6Si — CID 6709721
[3-acetyloxy-6-(2-methylidene-5-trimethylsilylpent-3-enoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 6709721) has the molecular formula C19H30O6Si and a molecular weight of 382.53 g/mol. Its IUPAC name is [3-acetyloxy-6-(2-methylidene-5-trimethylsilylpent-3-enoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-(2-methylidene-5-trimethylsilylpent-3-enoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6709721 |
| Molecular Formula | C19H30O6Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [3-acetyloxy-6-(2-methylidene-5-trimethylsilylpent-3-enoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C(C=CC[Si](C)(C)C)COC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C19H30O6Si/c1-14(8-7-11-26(4,5)6)12-23-19-10-9-17(24-16(3)21)18(25-19)13-22-15(2)20/h7-10,17-19H,1,11-13H2,2-6H3 |
| InChIKey | SOQIWMBUUXKRGO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|