C23H34N4O8 — CID 6709756
methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4,8-dioxo-2-propan-2-yl-7,18-dioxa-3,9,17-triazabicyclo[13.2.1]octadeca-1(17),11,15-triene-16-carboxylate (PubChem CID 6709756) has the molecular formula C23H34N4O8 and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4,8-dioxo-2-propan-2-yl-7,18-dioxa-3,9,17-triazabicyclo[13.2.1]octadeca-1(17),11,15-triene-16-carboxylate.
| Compound Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4,8-dioxo-2-propan-2-yl-7,18-dioxa-3,9,17-triazabicyclo[13.2.1]octadeca-1(17),11,15-triene-16-carboxylate |
|---|---|
| PubChem CID | 6709756 |
| Molecular Formula | C23H34N4O8 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4,8-dioxo-2-propan-2-yl-7,18-dioxa-3,9,17-triazabicyclo[13.2.1]octadeca-1(17),11,15-triene-16-carboxylate |
| SMILES | COC(=O)c1nc2oc1CCC=CCNC(=O)OCC(NC(=O)OC(C)(C)C)C(=O)NC2C(C)C |
| InChI | InChI=1S/C23H34N4O8/c1-13(2)16-19-27-17(20(29)32-6)15(34-19)10-8-7-9-11-24-21(30)33-12-14(18(28)26-16)25-22(31)35-23(3,4)5/h7,9,13-14,16H,8,10-12H2,1-6H3,(H,24,30)(H,25,31)(H,26,28) |
| InChIKey | RRYAGJUXDGEIQK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 158.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|