C12H19NO3 — CID 6709784
(3R,11R)-3,11-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 6709784) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (3R,11R)-3,11-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (3R,11R)-3,11-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 6709784 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (3R,11R)-3,11-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | C[C@@H]1COC(=O)[C@H](C)CC=CCCC(=O)N1 |
| InChI | InChI=1S/C12H19NO3/c1-9-6-4-3-5-7-11(14)13-10(2)8-16-12(9)15/h3-4,9-10H,5-8H2,1-2H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | WQOVNBRZJJCJEW-NXEZZACHSA-N |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|