C24H31ClN4O2 — CID 67098449
3-methoxy-1-[4-[4-(2-methylquinolin-5-yl)piperazin-1-yl]butyl]pyridin-2-one;hydrochloride (PubChem CID 67098449) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 3-methoxy-1-[4-[4-(2-methylquinolin-5-yl)piperazin-1-yl]butyl]pyridin-2-one;hydrochloride.
| Compound Name | 3-methoxy-1-[4-[4-(2-methylquinolin-5-yl)piperazin-1-yl]butyl]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67098449 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-methoxy-1-[4-[4-(2-methylquinolin-5-yl)piperazin-1-yl]butyl]pyridin-2-one;hydrochloride |
| SMILES | COc1cccn(CCCCN2CCN(c3cccc4nc(C)ccc34)CC2)c1=O.Cl |
| InChI | InChI=1S/C24H30N4O2.ClH/c1-19-10-11-20-21(25-19)7-5-8-22(20)27-17-15-26(16-18-27)12-3-4-13-28-14-6-9-23(30-2)24(28)29;/h5-11,14H,3-4,12-13,15-18H2,1-2H3;1H |
| InChIKey | JCVFCNQSTXIVJK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|