C12H20N2O6 — CID 67099288
oxalic acid;(2R)-N-piperidin-4-yloxolane-2-carboxamide (PubChem CID 67099288) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is oxalic acid;(2R)-N-piperidin-4-yloxolane-2-carboxamide.
| Compound Name | oxalic acid;(2R)-N-piperidin-4-yloxolane-2-carboxamide |
|---|---|
| PubChem CID | 67099288 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | oxalic acid;(2R)-N-piperidin-4-yloxolane-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)[C@H]1CCCO1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H18N2O2.C2H2O4/c13-10(9-2-1-7-14-9)12-8-3-5-11-6-4-8;3-1(4)2(5)6/h8-9,11H,1-7H2,(H,12,13);(H,3,4)(H,5,6)/t9-;/m1./s1 |
| InChIKey | MLUGWXIGDPUMEC-SBSPUUFOSA-N |
| XLogP | -0.81 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|