About (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol
(2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol (PubChem CID 67099559) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol |
| PubChem CID | 67099559 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol |
| SMILES | Cc1cc(C)c(N)c(Nc2ccc(C[C@H](C)O)cc2)n1 |
| InChI | InChI=1S/C16H21N3O/c1-10-8-11(2)18-16(15(10)17)19-14-6-4-13(5-7-14)9-12(3)20/h4-8,12,20H,9,17H2,1-3H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | JCGXUCRCYIIZOF-LBPRGKRZSA-N |
| XLogP | 2.95 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol?
The IUPAC name of (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol (CID 67099559) is (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol.
What is the SMILES notation for (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol?
The canonical SMILES for (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol is Cc1cc(C)c(N)c(Nc2ccc(C[C@H](C)O)cc2)n1.
What is the InChIKey of (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol?
The InChIKey is JCGXUCRCYIIZOF-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H21N3O/c1-10-8-11(2)18-16(15(10)17)19-14-6-4-13(5-7-14)9-12(3)20/h4-8,12,20H,9,17H2,1-3H3,(H,18,19)/t12-/m0/s1.
What are the key properties of (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol?
(2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol has a molecular weight of 271.36 g/mol, XLogP of 2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4-[(3-amino-4,6-dimethyl-2-pyridinyl)amino]phenyl]propan-2-ol is sourced from PubChem (CID 67099559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).