About ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate
ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate (PubChem CID 67099777) has the molecular formula C17H17ClO5
and a molecular weight of 336.77 g/mol. Its IUPAC name is ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate |
| PubChem CID | 67099777 |
| Molecular Formula | C17H17ClO5 |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate |
| SMILES | CCOC(=O)C1=C(O)c2cc(Cl)ccc2C2(CCOCC2)C1=O |
| InChI | InChI=1S/C17H17ClO5/c1-2-23-16(21)13-14(19)11-9-10(18)3-4-12(11)17(15(13)20)5-7-22-8-6-17/h3-4,9,19H,2,5-8H2,1H3 |
| InChIKey | INVSZROFJVCZCR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate?
The IUPAC name of ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate (CID 67099777) is ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate.
What is the SMILES notation for ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate?
The canonical SMILES for ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate is CCOC(=O)C1=C(O)c2cc(Cl)ccc2C2(CCOCC2)C1=O.
What is the InChIKey of ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate?
The InChIKey is INVSZROFJVCZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClO5/c1-2-23-16(21)13-14(19)11-9-10(18)3-4-12(11)17(15(13)20)5-7-22-8-6-17/h3-4,9,19H,2,5-8H2,1H3.
What are the key properties of ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate?
ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate has a molecular weight of 336.77 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-1-hydroxy-3-oxospiro[naphthalene-4,4'-oxane]-2-carboxylate is sourced from PubChem (CID 67099777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).