C9H9BN2 — CID 67099831
1,3-diaza-6-boratricyclo[7.3.0.03,7]dodeca-5,7,9,11-tetraene (PubChem CID 67099831) has the molecular formula C9H9BN2 and a molecular weight of 156.00 g/mol. Its IUPAC name is 1,3-diaza-6-boratricyclo[7.3.0.03,7]dodeca-5,7,9,11-tetraene.
| Compound Name | 1,3-diaza-6-boratricyclo[7.3.0.03,7]dodeca-5,7,9,11-tetraene |
|---|---|
| PubChem CID | 67099831 |
| Molecular Formula | C9H9BN2 |
| Molecular Weight | 156.00 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,3-diaza-6-boratricyclo[7.3.0.03,7]dodeca-5,7,9,11-tetraene |
| SMILES | B1=CCN2Cn3cccc3C=C12 |
| InChI | InChI=1S/C9H9BN2/c1-2-8-6-9-10-3-5-12(9)7-11(8)4-1/h1-4,6H,5,7H2 |
| InChIKey | CTQCEHLXTQTUDY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.00 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|