About 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide
4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide (PubChem CID 67099921) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide.
Molecular Properties
| Compound Name | 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide |
| PubChem CID | 67099921 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide |
| SMILES | NNC(=O)C1=CCC(=O)C=C1C(=O)NN |
| InChI | InChI=1S/C8H10N4O3/c9-11-7(14)5-2-1-4(13)3-6(5)8(15)12-10/h2-3H,1,9-10H2,(H,11,14)(H,12,15) |
| InChIKey | ATUFKTKEFRVHEH-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide?
The IUPAC name of 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide (CID 67099921) is 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide.
What is the SMILES notation for 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide?
The canonical SMILES for 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide is NNC(=O)C1=CCC(=O)C=C1C(=O)NN.
What is the InChIKey of 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide?
The InChIKey is ATUFKTKEFRVHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c9-11-7(14)5-2-1-4(13)3-6(5)8(15)12-10/h2-3H,1,9-10H2,(H,11,14)(H,12,15).
What are the key properties of 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide?
4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide has a molecular weight of 210.19 g/mol, XLogP of -2.21, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxocyclohexa-2,6-diene-1,2-dicarbohydrazide is sourced from PubChem (CID 67099921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).