C22H27NO7 — CID 6709995
prop-2-enyl (2S,6S,7S)-7-[(2S)-2-hydroxypent-4-enyl]-4,4-dimethyl-3,5,12,14-tetraoxa-8-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene-8-carboxylate (PubChem CID 6709995) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is prop-2-enyl (2S,6S,7S)-7-[(2S)-2-hydroxypent-4-enyl]-4,4-dimethyl-3,5,12,14-tetraoxa-8-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene-8-carboxylate.
| Compound Name | prop-2-enyl (2S,6S,7S)-7-[(2S)-2-hydroxypent-4-enyl]-4,4-dimethyl-3,5,12,14-tetraoxa-8-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene-8-carboxylate |
|---|---|
| PubChem CID | 6709995 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | prop-2-enyl (2S,6S,7S)-7-[(2S)-2-hydroxypent-4-enyl]-4,4-dimethyl-3,5,12,14-tetraoxa-8-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene-8-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc3c(cc2[C@@H]2OC(C)(C)O[C@H]2[C@@H]1C[C@@H](O)CC=C)OCO3 |
| InChI | InChI=1S/C22H27NO7/c1-5-7-13(24)9-16-20-19(29-22(3,4)30-20)14-10-17-18(28-12-27-17)11-15(14)23(16)21(25)26-8-6-2/h5-6,10-11,13,16,19-20,24H,1-2,7-9,12H2,3-4H3/t13-,16-,19-,20-/m0/s1 |
| InChIKey | QMRFXCHPTOVRCS-PQTDTLSBSA-N |
| XLogP | 3.45 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|