About 5-fluoro-1H-pyrimidine-2,4-dione;furan
5-fluoro-1H-pyrimidine-2,4-dione;furan (PubChem CID 67100299) has the molecular formula C8H7FN2O3
and a molecular weight of 198.15 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;furan.
Molecular Properties
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;furan |
| PubChem CID | 67100299 |
| Molecular Formula | C8H7FN2O3 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;furan |
| SMILES | O=c1[nH]cc(F)c(=O)[nH]1.c1ccoc1 |
| InChI | InChI=1S/C4H3FN2O2.C4H4O/c5-2-1-6-4(9)7-3(2)8;1-2-4-5-3-1/h1H,(H2,6,7,8,9);1-4H |
| InChIKey | UPZLQZJZQSYUNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1H-pyrimidine-2,4-dione;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;furan?
The IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;furan (CID 67100299) is 5-fluoro-1H-pyrimidine-2,4-dione;furan.
What is the SMILES notation for 5-fluoro-1H-pyrimidine-2,4-dione;furan?
The canonical SMILES for 5-fluoro-1H-pyrimidine-2,4-dione;furan is O=c1[nH]cc(F)c(=O)[nH]1.c1ccoc1.
What is the InChIKey of 5-fluoro-1H-pyrimidine-2,4-dione;furan?
The InChIKey is UPZLQZJZQSYUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2O2.C4H4O/c5-2-1-6-4(9)7-3(2)8;1-2-4-5-3-1/h1H,(H2,6,7,8,9);1-4H.
What are the key properties of 5-fluoro-1H-pyrimidine-2,4-dione;furan?
5-fluoro-1H-pyrimidine-2,4-dione;furan has a molecular weight of 198.15 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-pyrimidine-2,4-dione;furan is sourced from PubChem (CID 67100299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).