About methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate
methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate (PubChem CID 67100534) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate.
Molecular Properties
| Compound Name | methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate |
| PubChem CID | 67100534 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(C)c1cn[nH]c1)C(C)(C)C |
| InChI | InChI=1S/C12H21N3O2/c1-8(9-6-13-14-7-9)15-10(11(16)17-5)12(2,3)4/h6-8,10,15H,1-5H3,(H,13,14)/t8?,10-/m1/s1 |
| InChIKey | QWBUDORCVMPEEM-LHIURRSHSA-N |
| XLogP | 1.65 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate?
The IUPAC name of methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate (CID 67100534) is methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate.
What is the SMILES notation for methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate?
The canonical SMILES for methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate is COC(=O)[C@@H](NC(C)c1cn[nH]c1)C(C)(C)C.
What is the InChIKey of methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate?
The InChIKey is QWBUDORCVMPEEM-LHIURRSHSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-8(9-6-13-14-7-9)15-10(11(16)17-5)12(2,3)4/h6-8,10,15H,1-5H3,(H,13,14)/t8?,10-/m1/s1.
What are the key properties of methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate?
methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate has a molecular weight of 239.32 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3,3-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylamino]butanoate is sourced from PubChem (CID 67100534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).