C13H15NO5 — CID 6710088
ethyl (6S,7S)-7-hydroxy-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline-6-carboxylate (PubChem CID 6710088) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl (6S,7S)-7-hydroxy-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline-6-carboxylate.
| Compound Name | ethyl (6S,7S)-7-hydroxy-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 6710088 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl (6S,7S)-7-hydroxy-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1Nc2cc3c(cc2C[C@@H]1O)OCO3 |
| InChI | InChI=1S/C13H15NO5/c1-2-17-13(16)12-9(15)3-7-4-10-11(19-6-18-10)5-8(7)14-12/h4-5,9,12,14-15H,2-3,6H2,1H3/t9-,12-/m0/s1 |
| InChIKey | IGGNNSLMPRVBJG-CABZTGNLSA-N |
| XLogP | 0.68 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|