C25H25N3O4S — CID 67101023
N-benzyl-2,4-dimethoxy-5-[2-(2-methylphenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67101023) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-benzyl-2,4-dimethoxy-5-[2-(2-methylphenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-benzyl-2,4-dimethoxy-5-[2-(2-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67101023 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-benzyl-2,4-dimethoxy-5-[2-(2-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCc2ccccc2)cc1-c1ccnn1-c1ccccc1C |
| InChI | InChI=1S/C25H25N3O4S/c1-18-9-7-8-12-21(18)28-22(13-14-26-28)20-15-25(24(32-3)16-23(20)31-2)33(29,30)27-17-19-10-5-4-6-11-19/h4-16,27H,17H2,1-3H3 |
| InChIKey | IZNWHGXUBUSIDS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |