C25H20ClN3O4 — CID 67101382
1-(2-chlorophenyl)-5-[2,4-dimethoxy-5-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]pyrazole (PubChem CID 67101382) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-[2,4-dimethoxy-5-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]pyrazole.
| Compound Name | 1-(2-chlorophenyl)-5-[2,4-dimethoxy-5-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]pyrazole |
|---|---|
| PubChem CID | 67101382 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-(2-chlorophenyl)-5-[2,4-dimethoxy-5-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]pyrazole |
| SMILES | COc1cc(OC)c(-c2ccnn2-c2ccccc2Cl)cc1/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20ClN3O4/c1-32-24-16-25(33-2)20(22-12-13-27-28(22)23-9-4-3-8-21(23)26)15-18(24)11-10-17-6-5-7-19(14-17)29(30)31/h3-16H,1-2H3/b11-10+ |
| InChIKey | QHHSIYVPAUHKIS-ZHACJKMWSA-N |
| XLogP | 6.29 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|