About 1-oxo-2,3-dihydrothiophen-3-amine
1-oxo-2,3-dihydrothiophen-3-amine (PubChem CID 67101456) has the molecular formula C4H7NOS
and a molecular weight of 117.17 g/mol. Its IUPAC name is 1-oxo-2,3-dihydrothiophen-3-amine.
Molecular Properties
| Compound Name | 1-oxo-2,3-dihydrothiophen-3-amine |
| PubChem CID | 67101456 |
| Molecular Formula | C4H7NOS |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | 1-oxo-2,3-dihydrothiophen-3-amine |
| SMILES | NC1C=CS(=O)C1 |
| InChI | InChI=1S/C4H7NOS/c5-4-1-2-7(6)3-4/h1-2,4H,3,5H2 |
| InChIKey | XWRYYSRXVWQGME-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxo-2,3-dihydrothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-2,3-dihydrothiophen-3-amine?
The IUPAC name of 1-oxo-2,3-dihydrothiophen-3-amine (CID 67101456) is 1-oxo-2,3-dihydrothiophen-3-amine.
What is the SMILES notation for 1-oxo-2,3-dihydrothiophen-3-amine?
The canonical SMILES for 1-oxo-2,3-dihydrothiophen-3-amine is NC1C=CS(=O)C1.
What is the InChIKey of 1-oxo-2,3-dihydrothiophen-3-amine?
The InChIKey is XWRYYSRXVWQGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS/c5-4-1-2-7(6)3-4/h1-2,4H,3,5H2.
What are the key properties of 1-oxo-2,3-dihydrothiophen-3-amine?
1-oxo-2,3-dihydrothiophen-3-amine has a molecular weight of 117.17 g/mol, XLogP of -0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-2,3-dihydrothiophen-3-amine is sourced from PubChem (CID 67101456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).