About 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine
8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine (PubChem CID 67101905) has the molecular formula C20H19F2N3O
and a molecular weight of 355.39 g/mol. Its IUPAC name is 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine.
Molecular Properties
| Compound Name | 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine |
| PubChem CID | 67101905 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine |
| SMILES | Fc1ccc(F)c(CNc2ncc3cccc(OC4CCCC4)c3n2)c1 |
| InChI | InChI=1S/C20H19F2N3O/c21-15-8-9-17(22)14(10-15)12-24-20-23-11-13-4-3-7-18(19(13)25-20)26-16-5-1-2-6-16/h3-4,7-11,16H,1-2,5-6,12H2,(H,23,24,25) |
| InChIKey | PEGQQUHMLZFDTM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine?
The IUPAC name of 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine (CID 67101905) is 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine.
What is the SMILES notation for 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine?
The canonical SMILES for 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine is Fc1ccc(F)c(CNc2ncc3cccc(OC4CCCC4)c3n2)c1.
What is the InChIKey of 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine?
The InChIKey is PEGQQUHMLZFDTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N3O/c21-15-8-9-17(22)14(10-15)12-24-20-23-11-13-4-3-7-18(19(13)25-20)26-16-5-1-2-6-16/h3-4,7-11,16H,1-2,5-6,12H2,(H,23,24,25).
What are the key properties of 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine?
8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine has a molecular weight of 355.39 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyloxy-N-[(2,5-difluorophenyl)methyl]quinazolin-2-amine is sourced from PubChem (CID 67101905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).