C28H43NO5Si — CID 6710216
(3aS,4R,7aR)-2-benzyl-4-(hydroxymethyl)-5-[1-hydroxy-2-tri(propan-2-yl)silyloxyethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 6710216) has the molecular formula C28H43NO5Si and a molecular weight of 501.74 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-benzyl-4-(hydroxymethyl)-5-[1-hydroxy-2-tri(propan-2-yl)silyloxyethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-benzyl-4-(hydroxymethyl)-5-[1-hydroxy-2-tri(propan-2-yl)silyloxyethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6710216 |
| Molecular Formula | C28H43NO5Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | (3aS,4R,7aR)-2-benzyl-4-(hydroxymethyl)-5-[1-hydroxy-2-tri(propan-2-yl)silyloxyethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=C(C(O)CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](CO)[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C28H43NO5Si/c1-17(2)35(18(3)4,19(5)6)34-16-24(31)25-20(7)13-22-26(23(25)15-30)28(33)29(27(22)32)14-21-11-9-8-10-12-21/h8-12,17-19,22-24,26,30-31H,13-16H2,1-7H3/t22-,23+,24?,26-/m1/s1 |
| InChIKey | RAOPGSLUGIPNKO-SVDLFDKWSA-N |
| XLogP | 4.67 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|