C31H37N5O2Si — CID 67102291
2,2-dimethyl-1-[2-[1-(pyridin-2-ylmethyl)indol-5-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one (PubChem CID 67102291) has the molecular formula C31H37N5O2Si and a molecular weight of 539.76 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-[1-(pyridin-2-ylmethyl)indol-5-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[2-[1-(pyridin-2-ylmethyl)indol-5-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 67102291 |
| Molecular Formula | C31H37N5O2Si |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 2,2-dimethyl-1-[2-[1-(pyridin-2-ylmethyl)indol-5-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3ccc4c(ccn4Cc4ccccn4)c3)nc12 |
| InChI | InChI=1S/C31H37N5O2Si/c1-31(2,3)29(37)25-20-36(21-38-15-16-39(4,5)6)30-28(25)34-26(18-33-30)22-10-11-27-23(17-22)12-14-35(27)19-24-9-7-8-13-32-24/h7-14,17-18,20H,15-16,19,21H2,1-6H3 |
| InChIKey | IHDNCKGEBXIZPF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|