C22H18F3N5OS — CID 67102316
7-piperidin-4-yloxy-6-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)quinazolin-2-amine (PubChem CID 67102316) has the molecular formula C22H18F3N5OS and a molecular weight of 457.48 g/mol. Its IUPAC name is 7-piperidin-4-yloxy-6-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)quinazolin-2-amine.
| Compound Name | 7-piperidin-4-yloxy-6-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 67102316 |
| Molecular Formula | C22H18F3N5OS |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 7-piperidin-4-yloxy-6-(1,3-thiazol-2-yl)-N-(3,4,5-trifluorophenyl)quinazolin-2-amine |
| SMILES | Fc1cc(Nc2ncc3cc(-c4nccs4)c(OC4CCNCC4)cc3n2)cc(F)c1F |
| InChI | InChI=1S/C22H18F3N5OS/c23-16-8-13(9-17(24)20(16)25)29-22-28-11-12-7-15(21-27-5-6-32-21)19(10-18(12)30-22)31-14-1-3-26-4-2-14/h5-11,14,26H,1-4H2,(H,28,29,30) |
| InChIKey | LNHBAKDTUVXYQZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|