C33H30N2O5S — CID 6710260
2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-1-benzyl-2-oxo-1'-phenyl-5'-thiophen-2-ylspiro[indole-3,4'-pyrrolidine]-2',3'-dicarboxylate (PubChem CID 6710260) has the molecular formula C33H30N2O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-1-benzyl-2-oxo-1'-phenyl-5'-thiophen-2-ylspiro[indole-3,4'-pyrrolidine]-2',3'-dicarboxylate.
| Compound Name | 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-1-benzyl-2-oxo-1'-phenyl-5'-thiophen-2-ylspiro[indole-3,4'-pyrrolidine]-2',3'-dicarboxylate |
|---|---|
| PubChem CID | 6710260 |
| Molecular Formula | C33H30N2O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-1-benzyl-2-oxo-1'-phenyl-5'-thiophen-2-ylspiro[indole-3,4'-pyrrolidine]-2',3'-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OC)[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@@H](c2cccs2)N1c1ccccc1 |
| InChI | InChI=1S/C33H30N2O5S/c1-3-40-31(37)28-27(30(36)39-2)33(29(26-19-12-20-41-26)35(28)23-15-8-5-9-16-23)24-17-10-11-18-25(24)34(32(33)38)21-22-13-6-4-7-14-22/h4-20,27-29H,3,21H2,1-2H3/t27-,28-,29+,33-/m0/s1 |
| InChIKey | YFIYRNMOSNTLRL-MKYOLNSUSA-N |
| XLogP | 5.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |