C26H27NO7S — CID 67102610
4-amino-2-(2-methoxyphenyl)-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]benzoic acid (PubChem CID 67102610) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-amino-2-(2-methoxyphenyl)-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]benzoic acid.
| Compound Name | 4-amino-2-(2-methoxyphenyl)-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 67102610 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4-amino-2-(2-methoxyphenyl)-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfinylmethyl]benzoic acid |
| SMILES | COc1cc(OC)c(C=CS(=O)Cc2cc(C(=O)O)c(-c3ccccc3OC)cc2N)c(OC)c1 |
| InChI | InChI=1S/C26H27NO7S/c1-31-17-12-24(33-3)19(25(13-17)34-4)9-10-35(30)15-16-11-21(26(28)29)20(14-22(16)27)18-7-5-6-8-23(18)32-2/h5-14H,15,27H2,1-4H3,(H,28,29) |
| InChIKey | KTXOICNPMRMDCU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|