C12H21N — CID 6710285
(4R,5R)-2,2,4-trimethyl-6-methylidene-3-azabicyclo[3.3.1]nonane (PubChem CID 6710285) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (4R,5R)-2,2,4-trimethyl-6-methylidene-3-azabicyclo[3.3.1]nonane.
| Compound Name | (4R,5R)-2,2,4-trimethyl-6-methylidene-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 6710285 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (4R,5R)-2,2,4-trimethyl-6-methylidene-3-azabicyclo[3.3.1]nonane |
| SMILES | C=C1CCC2C[C@H]1[C@@H](C)NC2(C)C |
| InChI | InChI=1S/C12H21N/c1-8-5-6-10-7-11(8)9(2)13-12(10,3)4/h9-11,13H,1,5-7H2,2-4H3/t9-,10?,11-/m1/s1 |
| InChIKey | OCJWLGYTEAYOPG-GLYLRITDSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|