C15H27N — CID 6710287
(4R,5R)-2,2-dimethyl-6-methylidene-4-(2-methylpropyl)-3-azabicyclo[3.3.1]nonane (PubChem CID 6710287) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-6-methylidene-4-(2-methylpropyl)-3-azabicyclo[3.3.1]nonane.
| Compound Name | (4R,5R)-2,2-dimethyl-6-methylidene-4-(2-methylpropyl)-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 6710287 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-6-methylidene-4-(2-methylpropyl)-3-azabicyclo[3.3.1]nonane |
| SMILES | C=C1CCC2C[C@H]1[C@@H](CC(C)C)NC2(C)C |
| InChI | InChI=1S/C15H27N/c1-10(2)8-14-13-9-12(7-6-11(13)3)15(4,5)16-14/h10,12-14,16H,3,6-9H2,1-2,4-5H3/t12?,13-,14-/m1/s1 |
| InChIKey | BTITZFGDIMUTCT-ILMHWDKJSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|