C28H41N3O5 — CID 67103079
(2S,3S)-2-[[(2S,3S)-2-[[2-[(3S)-3-[(2S)-butan-2-yl]-1-oxo-2,3-dihydroisoquinolin-4-ylidene]acetyl]amino]-3-methylpentanoyl]amino]-2,3-dimethylpentanoic acid (PubChem CID 67103079) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S,3S)-2-[[2-[(3S)-3-[(2S)-butan-2-yl]-1-oxo-2,3-dihydroisoquinolin-4-ylidene]acetyl]amino]-3-methylpentanoyl]amino]-2,3-dimethylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2S,3S)-2-[[2-[(3S)-3-[(2S)-butan-2-yl]-1-oxo-2,3-dihydroisoquinolin-4-ylidene]acetyl]amino]-3-methylpentanoyl]amino]-2,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 67103079 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | (2S,3S)-2-[[(2S,3S)-2-[[2-[(3S)-3-[(2S)-butan-2-yl]-1-oxo-2,3-dihydroisoquinolin-4-ylidene]acetyl]amino]-3-methylpentanoyl]amino]-2,3-dimethylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C=C1c2ccccc2C(=O)N[C@H]1[C@@H](C)CC)C(=O)N[C@](C)(C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C28H41N3O5/c1-8-16(4)23-21(19-13-11-12-14-20(19)25(33)30-23)15-22(32)29-24(17(5)9-2)26(34)31-28(7,27(35)36)18(6)10-3/h11-18,23-24H,8-10H2,1-7H3,(H,29,32)(H,30,33)(H,31,34)(H,35,36)/t16-,17-,18-,23-,24-,28-/m0/s1 |
| InChIKey | WLGKMYVGFNPDIV-JFXTZGNCSA-N |
| XLogP | 3.76 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|