C26H38O2S — CID 67104096
6-but-1-enyl-2-(3-but-1-enyl-2,3,4-trimethylcyclohexa-1,5-dien-1-yl)sulfonyl-1,5,6-trimethylcyclohexa-1,3-diene (PubChem CID 67104096) has the molecular formula C26H38O2S and a molecular weight of 414.66 g/mol. Its IUPAC name is 6-but-1-enyl-2-(3-but-1-enyl-2,3,4-trimethylcyclohexa-1,5-dien-1-yl)sulfonyl-1,5,6-trimethylcyclohexa-1,3-diene.
| Compound Name | 6-but-1-enyl-2-(3-but-1-enyl-2,3,4-trimethylcyclohexa-1,5-dien-1-yl)sulfonyl-1,5,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67104096 |
| Molecular Formula | C26H38O2S |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 6-but-1-enyl-2-(3-but-1-enyl-2,3,4-trimethylcyclohexa-1,5-dien-1-yl)sulfonyl-1,5,6-trimethylcyclohexa-1,3-diene |
| SMILES | CCC=CC1(C)C(C)=C(S(=O)(=O)C2=C(C)C(C)(C=CCC)C(C)C=C2)C=CC1C |
| InChI | InChI=1S/C26H38O2S/c1-9-11-17-25(7)19(3)13-15-23(21(25)5)29(27,28)24-16-14-20(4)26(8,22(24)6)18-12-10-2/h11-20H,9-10H2,1-8H3 |
| InChIKey | TZXSHVHGYPQWEI-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|