About 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one
3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 67104201) has the molecular formula C27H17ClFNO3
and a molecular weight of 457.89 g/mol. Its IUPAC name is 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 67104201 |
| Molecular Formula | C27H17ClFNO3 |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1cc(F)ccc1Nc1ccc2c(c1)Oc1cc(Cl)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C27H17ClFNO3/c1-15-12-17(29)7-11-23(15)30-18-8-10-22-25(14-18)32-24-13-16(28)6-9-21(24)27(22)20-5-3-2-4-19(20)26(31)33-27/h2-14,30H,1H3 |
| InChIKey | IZJOLGVCISBJPN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (CID 67104201) is 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one is Cc1cc(F)ccc1Nc1ccc2c(c1)Oc1cc(Cl)ccc1C21OC(=O)c2ccccc21.
What is the InChIKey of 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is IZJOLGVCISBJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17ClFNO3/c1-15-12-17(29)7-11-23(15)30-18-8-10-22-25(14-18)32-24-13-16(28)6-9-21(24)27(22)20-5-3-2-4-19(20)26(31)33-27/h2-14,30H,1H3.
What are the key properties of 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 457.89 g/mol, XLogP of 7.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-chloro-6'-(4-fluoro-2-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 67104201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).