C11H12F3NO — CID 67104330
1-(1,2,3,4,4a,5-hexahydroisoquinolin-3-yl)-2,2,2-trifluoroethanone (PubChem CID 67104330) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5-hexahydroisoquinolin-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1,2,3,4,4a,5-hexahydroisoquinolin-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 67104330 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(1,2,3,4,4a,5-hexahydroisoquinolin-3-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(C1CC2CC=CC=C2CN1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO/c12-11(13,14)10(16)9-5-7-3-1-2-4-8(7)6-15-9/h1-2,4,7,9,15H,3,5-6H2 |
| InChIKey | LRRFNIIJMIZROX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |