C29H30F3N3O2 — CID 67104508
3-[1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]propylurea (PubChem CID 67104508) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is 3-[1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]propylurea.
| Compound Name | 3-[1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]propylurea |
|---|---|
| PubChem CID | 67104508 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 3-[1-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-4-(4-fluorophenyl)-2-oxopiperidin-4-yl]propylurea |
| SMILES | C[C@@H](c1ccc(-c2ccc(F)cc2F)cc1)N1CCC(CCCNC(N)=O)(c2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C29H30F3N3O2/c1-19(20-3-5-21(6-4-20)25-12-11-24(31)17-26(25)32)35-16-14-29(18-27(35)36,13-2-15-34-28(33)37)22-7-9-23(30)10-8-22/h3-12,17,19H,2,13-16,18H2,1H3,(H3,33,34,37)/t19-,29?/m0/s1 |
| InChIKey | UZQNMPSGHFMHCJ-KCHZNAQISA-N |
| XLogP | 5.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|