C37H33N7 — CID 67104658
5,10,15-tris(1-methyl-2H-pyridin-2-yl)-21H-corrin (PubChem CID 67104658) has the molecular formula C37H33N7 and a molecular weight of 575.72 g/mol. Its IUPAC name is 5,10,15-tris(1-methyl-2H-pyridin-2-yl)-21H-corrin.
| Compound Name | 5,10,15-tris(1-methyl-2H-pyridin-2-yl)-21H-corrin |
|---|---|
| PubChem CID | 67104658 |
| Molecular Formula | C37H33N7 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 5,10,15-tris(1-methyl-2H-pyridin-2-yl)-21H-corrin |
| SMILES | CN1C=CC=CC1/C1=C2\C=CC(=N2)/C(C2C=CC=CN2C)=C2/C=CC(=N2)/C(C2C=CC=CN2C)=c2/cc/c([nH]2)=C2\C=CC1=N2 |
| InChI | InChI=1S/C37H33N7/c1-42-21-7-4-10-32(42)35-26-15-13-24(38-26)25-14-16-27(39-25)36(33-11-5-8-22-43(33)2)29-18-20-31(41-29)37(30-19-17-28(35)40-30)34-12-6-9-23-44(34)3/h4-23,32-34,38H,1-3H3/b25-24-,35-26+,35-28+,36-27+,36-29+,37-30+,37-31+ |
| InChIKey | YUOXDJMAJUYMEE-QKUKPUCPSA-N |
| XLogP | 3.98 |
| TPSA | 62.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |