C36H43ClN2O7 — CID 67105685
1-[[6-(3-chlorophenoxy)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]non-8-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid (PubChem CID 67105685) has the molecular formula C36H43ClN2O7 and a molecular weight of 651.20 g/mol. Its IUPAC name is 1-[[6-(3-chlorophenoxy)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]non-8-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid.
| Compound Name | 1-[[6-(3-chlorophenoxy)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]non-8-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 67105685 |
| Molecular Formula | C36H43ClN2O7 |
| Molecular Weight | 651.20 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | 1-[[6-(3-chlorophenoxy)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]non-8-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
| SMILES | C=CCCCCCC(C(=O)OC(C)(C)C)C(=O)N1Cc2ccc(Oc3cccc(Cl)c3)cc2CC1C(=O)NC1(C(=O)O)CC1C=C |
| InChI | InChI=1S/C36H43ClN2O7/c1-6-8-9-10-11-15-29(33(42)46-35(3,4)5)32(41)39-22-23-16-17-28(45-27-14-12-13-26(37)20-27)18-24(23)19-30(39)31(40)38-36(34(43)44)21-25(36)7-2/h6-7,12-14,16-18,20,25,29-30H,1-2,8-11,15,19,21-22H2,3-5H3,(H,38,40)(H,43,44) |
| InChIKey | XVLWPHVYSMIQLH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.20 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|