About 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one
3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one (PubChem CID 6710578) has the molecular formula C18H14N2O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one |
| PubChem CID | 6710578 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one |
| SMILES | Cc1ccc(-c2csc(NC3OC(=O)c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C18H14N2O2S/c1-11-6-8-12(9-7-11)15-10-23-18(19-15)20-16-13-4-2-3-5-14(13)17(21)22-16/h2-10,16H,1H3,(H,19,20) |
| InChIKey | WNRWFAPNPSNQCK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one?
The IUPAC name of 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one (CID 6710578) is 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one?
The canonical SMILES for 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one is Cc1ccc(-c2csc(NC3OC(=O)c4ccccc43)n2)cc1.
What is the InChIKey of 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one?
The InChIKey is WNRWFAPNPSNQCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2S/c1-11-6-8-12(9-7-11)15-10-23-18(19-15)20-16-13-4-2-3-5-14(13)17(21)22-16/h2-10,16H,1H3,(H,19,20).
What are the key properties of 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one?
3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one has a molecular weight of 322.39 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-3H-2-benzofuran-1-one is sourced from PubChem (CID 6710578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).