About benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate
benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate (PubChem CID 67105910) has the molecular formula C17H17F2NO3
and a molecular weight of 321.32 g/mol. Its IUPAC name is benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate |
| PubChem CID | 67105910 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate |
| SMILES | C[C@](CO)(NC(=O)OCc1ccccc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H17F2NO3/c1-17(11-21,13-7-14(18)9-15(19)8-13)20-16(22)23-10-12-5-3-2-4-6-12/h2-9,21H,10-11H2,1H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | YZEJTXGUHJJHRE-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate?
The IUPAC name of benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate (CID 67105910) is benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate.
What is the SMILES notation for benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate?
The canonical SMILES for benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate is C[C@](CO)(NC(=O)OCc1ccccc1)c1cc(F)cc(F)c1.
What is the InChIKey of benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate?
The InChIKey is YZEJTXGUHJJHRE-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H17F2NO3/c1-17(11-21,13-7-14(18)9-15(19)8-13)20-16(22)23-10-12-5-3-2-4-6-12/h2-9,21H,10-11H2,1H3,(H,20,22)/t17-/m1/s1.
What are the key properties of benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate?
benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate has a molecular weight of 321.32 g/mol, XLogP of 3.10, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2S)-2-(3,5-difluorophenyl)-1-hydroxypropan-2-yl]carbamate is sourced from PubChem (CID 67105910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).