C20H17FN2O3 — CID 6710602
1-[(4-fluorophenyl)methoxy]-N-(4-methylphenyl)-2-oxopyridine-3-carboxamide (PubChem CID 6710602) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methoxy]-N-(4-methylphenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methoxy]-N-(4-methylphenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 6710602 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methoxy]-N-(4-methylphenyl)-2-oxopyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccn(OCc3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C20H17FN2O3/c1-14-4-10-17(11-5-14)22-19(24)18-3-2-12-23(20(18)25)26-13-15-6-8-16(21)9-7-15/h2-12H,13H2,1H3,(H,22,24) |
| InChIKey | RQTGUSCKAMGXDJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |