About 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide
5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide (PubChem CID 67107224) has the molecular formula C19H13BrF2N2O2
and a molecular weight of 419.23 g/mol. Its IUPAC name is 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide.
Molecular Properties
| Compound Name | 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide |
| PubChem CID | 67107224 |
| Molecular Formula | C19H13BrF2N2O2 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cc(Br)ccc1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H13BrF2N2O2/c20-13-4-6-18(26-11-12-3-5-16(21)17(22)8-12)15(9-13)19(25)24-14-2-1-7-23-10-14/h1-10H,11H2,(H,24,25) |
| InChIKey | AEDRMOJVXSDLTA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide?
The IUPAC name of 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide (CID 67107224) is 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide.
What is the SMILES notation for 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide?
The canonical SMILES for 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide is O=C(Nc1cccnc1)c1cc(Br)ccc1OCc1ccc(F)c(F)c1.
What is the InChIKey of 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide?
The InChIKey is AEDRMOJVXSDLTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrF2N2O2/c20-13-4-6-18(26-11-12-3-5-16(21)17(22)8-12)15(9-13)19(25)24-14-2-1-7-23-10-14/h1-10H,11H2,(H,24,25).
What are the key properties of 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide?
5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide has a molecular weight of 419.23 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(3,4-difluorophenyl)methoxy]-N-pyridin-3-ylbenzamide is sourced from PubChem (CID 67107224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).