About 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol
7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 67107270) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol.
Molecular Properties
| Compound Name | 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol |
| PubChem CID | 67107270 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | C=CCc1ccc(O)c2c1OCC2 |
| InChI | InChI=1S/C11H12O2/c1-2-3-8-4-5-10(12)9-6-7-13-11(8)9/h2,4-5,12H,1,3,6-7H2 |
| InChIKey | DHGOWNVHMMADGA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol?
The IUPAC name of 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol (CID 67107270) is 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol.
What is the SMILES notation for 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol?
The canonical SMILES for 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol is C=CCc1ccc(O)c2c1OCC2.
What is the InChIKey of 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol?
The InChIKey is DHGOWNVHMMADGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-2-3-8-4-5-10(12)9-6-7-13-11(8)9/h2,4-5,12H,1,3,6-7H2.
What are the key properties of 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol?
7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol has a molecular weight of 176.22 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-prop-2-enyl-2,3-dihydro-1-benzofuran-4-ol is sourced from PubChem (CID 67107270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).