C15H10O8 — CID 6710774
2-acetyl-3,4,8-trihydroxy-7-methoxybenzo[f][1]benzofuran-5,6-dione (PubChem CID 6710774) has the molecular formula C15H10O8 and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-acetyl-3,4,8-trihydroxy-7-methoxybenzo[f][1]benzofuran-5,6-dione.
| Compound Name | 2-acetyl-3,4,8-trihydroxy-7-methoxybenzo[f][1]benzofuran-5,6-dione |
|---|---|
| PubChem CID | 6710774 |
| Molecular Formula | C15H10O8 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-acetyl-3,4,8-trihydroxy-7-methoxybenzo[f][1]benzofuran-5,6-dione |
| SMILES | COC1=C(O)c2cc3oc(C(C)=O)c(O)c3c(O)c2C(=O)C1=O |
| InChI | InChI=1S/C15H10O8/c1-4(16)14-12(20)8-6(23-14)3-5-7(10(8)18)11(19)13(21)15(22-2)9(5)17/h3,17-18,20H,1-2H3 |
| InChIKey | XKWWCTISHMFHJB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|