C33H34N2O10 — CID 67107795
2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole (PubChem CID 67107795) has the molecular formula C33H34N2O10 and a molecular weight of 618.64 g/mol. Its IUPAC name is 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 67107795 |
| Molecular Formula | C33H34N2O10 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;2-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc2c(c1OC)CCCC2C1=NCCN1.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C15H20N2O2/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12;1-18-13-7-6-10-11(14(13)19-2)4-3-5-12(10)15-16-8-9-17-15/h1-10,25-26H,(H,21,22)(H,23,24);6-7,12H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | ICFBDACOAMRJRT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 192.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|