C24H39O5P — CID 67107887
[hydroxy(phenoxy)phosphoryl] octadec-9-enoate (PubChem CID 67107887) has the molecular formula C24H39O5P and a molecular weight of 438.55 g/mol. Its IUPAC name is [hydroxy(phenoxy)phosphoryl] octadec-9-enoate.
| Compound Name | [hydroxy(phenoxy)phosphoryl] octadec-9-enoate |
|---|---|
| PubChem CID | 67107887 |
| Molecular Formula | C24H39O5P |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [hydroxy(phenoxy)phosphoryl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C24H39O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-24(25)29-30(26,27)28-23-20-17-16-18-21-23/h9-10,16-18,20-21H,2-8,11-15,19,22H2,1H3,(H,26,27) |
| InChIKey | FMJHBCYGENSGSL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|