C21H21FN2O4 — CID 67108000
methyl 2-[(4-fluorophenyl)methoxy]-5-[1-(2-methoxyethyl)pyrazol-4-yl]benzoate (PubChem CID 67108000) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methoxy]-5-[1-(2-methoxyethyl)pyrazol-4-yl]benzoate.
| Compound Name | methyl 2-[(4-fluorophenyl)methoxy]-5-[1-(2-methoxyethyl)pyrazol-4-yl]benzoate |
|---|---|
| PubChem CID | 67108000 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methoxy]-5-[1-(2-methoxyethyl)pyrazol-4-yl]benzoate |
| SMILES | COCCn1cc(-c2ccc(OCc3ccc(F)cc3)c(C(=O)OC)c2)cn1 |
| InChI | InChI=1S/C21H21FN2O4/c1-26-10-9-24-13-17(12-23-24)16-5-8-20(19(11-16)21(25)27-2)28-14-15-3-6-18(22)7-4-15/h3-8,11-13H,9-10,14H2,1-2H3 |
| InChIKey | JHKDXHUXMLNNAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |