About hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride
hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride (PubChem CID 67108062) has the molecular formula C20H25ClN2O
and a molecular weight of 344.89 g/mol. Its IUPAC name is hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride.
Molecular Properties
| Compound Name | hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride |
| PubChem CID | 67108062 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride |
| SMILES | CC(C)NCCCC1(C(N)=O)c2ccccc2-c2ccccc21.[Cl-].[H+] |
| InChI | InChI=1S/C20H24N2O.ClH/c1-14(2)22-13-7-12-20(19(21)23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20;/h3-6,8-11,14,22H,7,12-13H2,1-2H3,(H2,21,23);1H |
| InChIKey | NXNSCUZKMVYAJQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride?
The IUPAC name of hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride (CID 67108062) is hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride.
What is the SMILES notation for hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride?
The canonical SMILES for hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride is CC(C)NCCCC1(C(N)=O)c2ccccc2-c2ccccc21.[Cl-].[H+].
What is the InChIKey of hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride?
The InChIKey is NXNSCUZKMVYAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O.ClH/c1-14(2)22-13-7-12-20(19(21)23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20;/h3-6,8-11,14,22H,7,12-13H2,1-2H3,(H2,21,23);1H.
What are the key properties of hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride?
hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride has a molecular weight of 344.89 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide;chloride is sourced from PubChem (CID 67108062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).