About 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride
3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride (PubChem CID 67108178) has the molecular formula C17H25ClN2O2
and a molecular weight of 324.85 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride.
Molecular Properties
| Compound Name | 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride |
| PubChem CID | 67108178 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride |
| SMILES | CCN(CC)CCC1(c2ccccc2)CCC(=O)NC1=O.[Cl-].[H+] |
| InChI | InChI=1S/C17H24N2O2.ClH/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21;/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21);1H |
| InChIKey | SYSHPMOZZLONAK-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride?
The IUPAC name of 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride (CID 67108178) is 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride.
What is the SMILES notation for 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride?
The canonical SMILES for 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride is CCN(CC)CCC1(c2ccccc2)CCC(=O)NC1=O.[Cl-].[H+].
What is the InChIKey of 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride?
The InChIKey is SYSHPMOZZLONAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2.ClH/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21;/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21);1H.
What are the key properties of 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride?
3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride has a molecular weight of 324.85 g/mol, XLogP of -0.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(diethylamino)ethyl]-3-phenylpiperidine-2,6-dione;hydron;chloride is sourced from PubChem (CID 67108178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).